C23H16FN3O3 — CID 170525204
3-fluoro-2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid (PubChem CID 170525204) has the molecular formula C23H16FN3O3 and a molecular weight of 401.40 g/mol. Its IUPAC name is 3-fluoro-2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid.
| Compound Name | 3-fluoro-2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 170525204 |
| Molecular Formula | C23H16FN3O3 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-fluoro-2-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylideneamino]benzoic acid |
| SMILES | O=C(O)c1cccc(F)c1/N=C/c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C23H16FN3O3/c24-19-13-7-12-17(23(29)30)21(19)25-14-18-20(15-8-3-1-4-9-15)26-27(22(18)28)16-10-5-2-6-11-16/h1-14,26H,(H,29,30)/b25-14+ |
| InChIKey | REBTVUQLBVTRPP-AFUMVMLFSA-N |
| XLogP | 4.42 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|