C27H22N4O4 — CID 170525151
2-[[5-(4-ethylphenyl)-2-(3-isocyanophenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]-4-(hydroxymethyl)benzoic acid (PubChem CID 170525151) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 2-[[5-(4-ethylphenyl)-2-(3-isocyanophenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]-4-(hydroxymethyl)benzoic acid.
| Compound Name | 2-[[5-(4-ethylphenyl)-2-(3-isocyanophenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]-4-(hydroxymethyl)benzoic acid |
|---|---|
| PubChem CID | 170525151 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[[5-(4-ethylphenyl)-2-(3-isocyanophenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]-4-(hydroxymethyl)benzoic acid |
| SMILES | [C-]#[N+]c1cccc(-n2[nH]c(-c3ccc(CC)cc3)c(/C=N/c3cc(CO)ccc3C(=O)O)c2=O)c1 |
| InChI | InChI=1S/C27H22N4O4/c1-3-17-7-10-19(11-8-17)25-23(15-29-24-13-18(16-32)9-12-22(24)27(34)35)26(33)31(30-25)21-6-4-5-20(14-21)28-2/h4-15,30,32H,3,16H2,1H3,(H,34,35)/b29-15+ |
| InChIKey | SUPDPPZLUSGOTL-WKULSOCRSA-N |
| XLogP | 4.89 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|