C26H22FN3O3 — CID 170524737
2-[[2-(4-ethylphenyl)-5-(3-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]-3-fluorobenzoic acid (PubChem CID 170524737) has the molecular formula C26H22FN3O3 and a molecular weight of 443.48 g/mol. Its IUPAC name is 2-[[2-(4-ethylphenyl)-5-(3-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]-3-fluorobenzoic acid.
| Compound Name | 2-[[2-(4-ethylphenyl)-5-(3-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 170524737 |
| Molecular Formula | C26H22FN3O3 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-[[2-(4-ethylphenyl)-5-(3-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]-3-fluorobenzoic acid |
| SMILES | CCc1ccc(-n2[nH]c(-c3cccc(C)c3)c(/C=N/c3c(F)cccc3C(=O)O)c2=O)cc1 |
| InChI | InChI=1S/C26H22FN3O3/c1-3-17-10-12-19(13-11-17)30-25(31)21(23(29-30)18-7-4-6-16(2)14-18)15-28-24-20(26(32)33)8-5-9-22(24)27/h4-15,29H,3H2,1-2H3,(H,32,33)/b28-15+ |
| InChIKey | YSITZEVEKXUPLX-RWPZCVJISA-N |
| XLogP | 5.29 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|