C21H15Cl3N4O2 — CID 1203065
5-methyl-4-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one (PubChem CID 1203065) has the molecular formula C21H15Cl3N4O2 and a molecular weight of 461.74 g/mol. Its IUPAC name is 5-methyl-4-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one.
| Compound Name | 5-methyl-4-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 1203065 |
| Molecular Formula | C21H15Cl3N4O2 |
| Molecular Weight | 461.74 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 5-methyl-4-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=Cc1c(C)[nH]n(-c2c(Cl)cc(Cl)cc2Cl)c1=O |
| InChI | InChI=1S/C21H15Cl3N4O2/c1-11-15(20(29)27(25-11)14-6-4-3-5-7-14)10-16-12(2)26-28(21(16)30)19-17(23)8-13(22)9-18(19)24/h3-10,26H,1-2H3 |
| InChIKey | XOPNUIYWJNSFJU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.74 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|