C21H12Cl6N4O2 — CID 75137178
5-methyl-4-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylidene]-2-(2,4,6-trichlorophenyl)pyrazol-3-one (PubChem CID 75137178) has the molecular formula C21H12Cl6N4O2 and a molecular weight of 565.07 g/mol. Its IUPAC name is 5-methyl-4-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylidene]-2-(2,4,6-trichlorophenyl)pyrazol-3-one.
| Compound Name | 5-methyl-4-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylidene]-2-(2,4,6-trichlorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 75137178 |
| Molecular Formula | C21H12Cl6N4O2 |
| Molecular Weight | 565.07 g/mol |
| Exact Mass | 561.91 |
| IUPAC Name | 5-methyl-4-[[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]methylidene]-2-(2,4,6-trichlorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(Cl)cc(Cl)cc2Cl)C(=O)C1=Cc1c(C)[nH]n(-c2c(Cl)cc(Cl)cc2Cl)c1=O |
| InChI | InChI=1S/C21H12Cl6N4O2/c1-8-12(20(32)30(28-8)18-14(24)3-10(22)4-15(18)25)7-13-9(2)29-31(21(13)33)19-16(26)5-11(23)6-17(19)27/h3-7,28H,1-2H3 |
| InChIKey | AXNMHKRZDFRNJD-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.07 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|