C21H16N6O6 — CID 15960358
(4Z)-5-methyl-4-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]-2-(4-nitrophenyl)pyrazol-3-one (PubChem CID 15960358) has the molecular formula C21H16N6O6 and a molecular weight of 448.40 g/mol. Its IUPAC name is (4Z)-5-methyl-4-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]-2-(4-nitrophenyl)pyrazol-3-one.
| Compound Name | (4Z)-5-methyl-4-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]-2-(4-nitrophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 15960358 |
| Molecular Formula | C21H16N6O6 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (4Z)-5-methyl-4-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]-2-(4-nitrophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2)C(=O)/C1=C\c1c(C)[nH]n(-c2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C21H16N6O6/c1-12-18(20(28)24(22-12)14-3-7-16(8-4-14)26(30)31)11-19-13(2)23-25(21(19)29)15-5-9-17(10-6-15)27(32)33/h3-11,22H,1-2H3/b19-11- |
| InChIKey | YYKMWSVBHVHIGL-ODLFYWEKSA-N |
| XLogP | 3.10 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|