C21H16ClIN4O2 — CID 1002925
(4Z)-2-(3-chlorophenyl)-4-[[2-(4-iodophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-5-methylpyrazol-3-one (PubChem CID 1002925) has the molecular formula C21H16ClIN4O2 and a molecular weight of 518.74 g/mol. Its IUPAC name is (4Z)-2-(3-chlorophenyl)-4-[[2-(4-iodophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4Z)-2-(3-chlorophenyl)-4-[[2-(4-iodophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 1002925 |
| Molecular Formula | C21H16ClIN4O2 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | (4Z)-2-(3-chlorophenyl)-4-[[2-(4-iodophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(c2cccc(Cl)c2)C(=O)/C1=C\c1c(C)[nH]n(-c2ccc(I)cc2)c1=O |
| InChI | InChI=1S/C21H16ClIN4O2/c1-12-18(20(28)26(24-12)16-8-6-15(23)7-9-16)11-19-13(2)25-27(21(19)29)17-5-3-4-14(22)10-17/h3-11,24H,1-2H3/b19-11- |
| InChIKey | QSGHGJOYINLIJY-ODLFYWEKSA-N |
| XLogP | 4.54 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|