C15H13ClN4O2 — CID 1224719
2-(3-chlorophenyl)-5-methyl-4-[(3-methyl-5-oxo-1H-pyrazol-4-ylidene)methyl]-1H-pyrazol-3-one (PubChem CID 1224719) has the molecular formula C15H13ClN4O2 and a molecular weight of 316.75 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-methyl-4-[(3-methyl-5-oxo-1H-pyrazol-4-ylidene)methyl]-1H-pyrazol-3-one.
| Compound Name | 2-(3-chlorophenyl)-5-methyl-4-[(3-methyl-5-oxo-1H-pyrazol-4-ylidene)methyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 1224719 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-(3-chlorophenyl)-5-methyl-4-[(3-methyl-5-oxo-1H-pyrazol-4-ylidene)methyl]-1H-pyrazol-3-one |
| SMILES | CC1=NNC(=O)C1=Cc1c(C)[nH]n(-c2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C15H13ClN4O2/c1-8-12(14(21)18-17-8)7-13-9(2)19-20(15(13)22)11-5-3-4-10(16)6-11/h3-7,19H,1-2H3,(H,18,21) |
| InChIKey | VSGRCBVLYBOERQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|