C22H19BrN4O2 — CID 5341507
(4Z)-2-(4-bromophenyl)-5-methyl-4-[[5-methyl-2-(4-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]pyrazol-3-one (PubChem CID 5341507) has the molecular formula C22H19BrN4O2 and a molecular weight of 451.32 g/mol. Its IUPAC name is (4Z)-2-(4-bromophenyl)-5-methyl-4-[[5-methyl-2-(4-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]pyrazol-3-one.
| Compound Name | (4Z)-2-(4-bromophenyl)-5-methyl-4-[[5-methyl-2-(4-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 5341507 |
| Molecular Formula | C22H19BrN4O2 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | (4Z)-2-(4-bromophenyl)-5-methyl-4-[[5-methyl-2-(4-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(Br)cc2)C(=O)/C1=C\c1c(C)[nH]n(-c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C22H19BrN4O2/c1-13-4-8-17(9-5-13)26-21(28)19(14(2)24-26)12-20-15(3)25-27(22(20)29)18-10-6-16(23)7-11-18/h4-12,24H,1-3H3/b20-12- |
| InChIKey | BJTVCEBMCQAAHS-NDENLUEZSA-N |
| XLogP | 4.35 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|