C20H14ClFN4O3 — CID 135486358
4-[[2-(3-chloro-4-fluorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 135486358) has the molecular formula C20H14ClFN4O3 and a molecular weight of 412.81 g/mol. Its IUPAC name is 4-[[2-(3-chloro-4-fluorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[2-(3-chloro-4-fluorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 135486358 |
| Molecular Formula | C20H14ClFN4O3 |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 4-[[2-(3-chloro-4-fluorophenyl)-3-hydroxy-5-oxo-1H-pyrazol-4-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=Cc1c(O)n(-c2ccc(F)c(Cl)c2)[nH]c1=O |
| InChI | InChI=1S/C20H14ClFN4O3/c1-11-14(19(28)25(23-11)12-5-3-2-4-6-12)10-15-18(27)24-26(20(15)29)13-7-8-17(22)16(21)9-13/h2-10,29H,1H3,(H,24,27) |
| InChIKey | UDTUWRGKXQEPLD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|