C17H11Cl2FN2O — CID 78464044
2-(3,4-dichlorophenyl)-4-[(2-fluorophenyl)methylidene]-5-methylpyrazol-3-one (PubChem CID 78464044) has the molecular formula C17H11Cl2FN2O and a molecular weight of 349.19 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-[(2-fluorophenyl)methylidene]-5-methylpyrazol-3-one.
| Compound Name | 2-(3,4-dichlorophenyl)-4-[(2-fluorophenyl)methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 78464044 |
| Molecular Formula | C17H11Cl2FN2O |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-[(2-fluorophenyl)methylidene]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(c2ccc(Cl)c(Cl)c2)C(=O)C1=Cc1ccccc1F |
| InChI | InChI=1S/C17H11Cl2FN2O/c1-10-13(8-11-4-2-3-5-16(11)20)17(23)22(21-10)12-6-7-14(18)15(19)9-12/h2-9H,1H3 |
| InChIKey | NUDZHXCEETVVKU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|