C19H16Cl2N2O — CID 6023463
(4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(3,4-dimethylphenyl)-5-methylpyrazol-3-one (PubChem CID 6023463) has the molecular formula C19H16Cl2N2O and a molecular weight of 359.26 g/mol. Its IUPAC name is (4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(3,4-dimethylphenyl)-5-methylpyrazol-3-one.
| Compound Name | (4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(3,4-dimethylphenyl)-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 6023463 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(3,4-dimethylphenyl)-5-methylpyrazol-3-one |
| SMILES | CC1=NN(c2ccc(C)c(C)c2)C(=O)/C1=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O/c1-11-4-7-16(8-12(11)2)23-19(24)17(13(3)22-23)9-14-5-6-15(20)10-18(14)21/h4-10H,1-3H3/b17-9- |
| InChIKey | HVIFKFVTBHIIGY-MFOYZWKCSA-N |
| XLogP | 5.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|