C21H14Cl2N2O — CID 7827599
(4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-methyl-2-naphthalen-2-ylpyrazol-3-one (PubChem CID 7827599) has the molecular formula C21H14Cl2N2O and a molecular weight of 381.26 g/mol. Its IUPAC name is (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-methyl-2-naphthalen-2-ylpyrazol-3-one.
| Compound Name | (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-methyl-2-naphthalen-2-ylpyrazol-3-one |
|---|---|
| PubChem CID | 7827599 |
| Molecular Formula | C21H14Cl2N2O |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-methyl-2-naphthalen-2-ylpyrazol-3-one |
| SMILES | CC1=NN(c2ccc3ccccc3c2)C(=O)/C1=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H14Cl2N2O/c1-13-19(11-16-6-8-17(22)12-20(16)23)21(26)25(24-13)18-9-7-14-4-2-3-5-15(14)10-18/h2-12H,1H3/b19-11- |
| InChIKey | SYBMITZDXQVOAT-ODLFYWEKSA-N |
| XLogP | 5.95 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|