C19H13Cl2N3O2 — CID 6536723
2-[2-[(E)-[1-(3,4-dichlorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenoxy]acetonitrile (PubChem CID 6536723) has the molecular formula C19H13Cl2N3O2 and a molecular weight of 386.24 g/mol. Its IUPAC name is 2-[2-[(E)-[1-(3,4-dichlorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-[(E)-[1-(3,4-dichlorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 6536723 |
| Molecular Formula | C19H13Cl2N3O2 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-[2-[(E)-[1-(3,4-dichlorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenoxy]acetonitrile |
| SMILES | CC1=NN(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C/c1ccccc1OCC#N |
| InChI | InChI=1S/C19H13Cl2N3O2/c1-12-15(10-13-4-2-3-5-18(13)26-9-8-22)19(25)24(23-12)14-6-7-16(20)17(21)11-14/h2-7,10-11H,9H2,1H3/b15-10+ |
| InChIKey | UEBIBEVENUWIJS-XNTDXEJSSA-N |
| XLogP | 4.70 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|