C16H13N7O2 — CID 24773852
N-[(E)-(2-azido-5-cyano-1,4-dimethyl-6-oxo-3-pyridinyl)methylideneamino]benzamide (PubChem CID 24773852) has the molecular formula C16H13N7O2 and a molecular weight of 335.33 g/mol. Its IUPAC name is N-[(E)-(2-azido-5-cyano-1,4-dimethyl-6-oxo-3-pyridinyl)methylideneamino]benzamide.
| Compound Name | N-[(E)-(2-azido-5-cyano-1,4-dimethyl-6-oxo-3-pyridinyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 24773852 |
| Molecular Formula | C16H13N7O2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[(E)-(2-azido-5-cyano-1,4-dimethyl-6-oxo-3-pyridinyl)methylideneamino]benzamide |
| SMILES | Cc1c(/C=N/NC(=O)c2ccccc2)c(N=[N+]=[N-])n(C)c(=O)c1C#N |
| InChI | InChI=1S/C16H13N7O2/c1-10-12(8-17)16(25)23(2)14(20-22-18)13(10)9-19-21-15(24)11-6-4-3-5-7-11/h3-7,9H,1-2H3,(H,21,24)/b19-9+ |
| InChIKey | JIVKZKXNNGHZRT-DJKKODMXSA-N |
| XLogP | 2.27 |
| TPSA | 136.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|