C17H12ClN5O3S — CID 135469715
N-[(E)-[1-(3-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide (PubChem CID 135469715) has the molecular formula C17H12ClN5O3S and a molecular weight of 401.84 g/mol. Its IUPAC name is N-[(E)-[1-(3-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[1-(3-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135469715 |
| Molecular Formula | C17H12ClN5O3S |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N-[(E)-[1-(3-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C/c1c(O)n(-c2cccc(Cl)c2)c(=S)[nH]c1=O)c1ccncc1 |
| InChI | InChI=1S/C17H12ClN5O3S/c18-11-2-1-3-12(8-11)23-16(26)13(15(25)21-17(23)27)9-20-22-14(24)10-4-6-19-7-5-10/h1-9,26H,(H,22,24)(H,21,25,27)/b20-9+ |
| InChIKey | CBBRCIQYZMLWEZ-AWQFTUOYSA-N |
| XLogP | 2.41 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|