C13H13N5O4S — CID 2024298
[[6-hydroxy-1-(3-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]urea (PubChem CID 2024298) has the molecular formula C13H13N5O4S and a molecular weight of 335.35 g/mol. Its IUPAC name is [[6-hydroxy-1-(3-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]urea.
| Compound Name | [[6-hydroxy-1-(3-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 2024298 |
| Molecular Formula | C13H13N5O4S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | [[6-hydroxy-1-(3-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]urea |
| SMILES | COc1cccc(-n2c(O)c(C=NNC(N)=O)c(=O)[nH]c2=S)c1 |
| InChI | InChI=1S/C13H13N5O4S/c1-22-8-4-2-3-7(5-8)18-11(20)9(6-15-17-12(14)21)10(19)16-13(18)23/h2-6,20H,1H3,(H3,14,17,21)(H,16,19,23) |
| InChIKey | DUVLAGREXVMBIB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 134.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|