C15H15ClN4O3S — CID 135485069
1-(3-chlorophenyl)-6-hydroxy-5-[(E)-morpholin-4-yliminomethyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 135485069) has the molecular formula C15H15ClN4O3S and a molecular weight of 366.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-6-hydroxy-5-[(E)-morpholin-4-yliminomethyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(3-chlorophenyl)-6-hydroxy-5-[(E)-morpholin-4-yliminomethyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135485069 |
| Molecular Formula | C15H15ClN4O3S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 1-(3-chlorophenyl)-6-hydroxy-5-[(E)-morpholin-4-yliminomethyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2cccc(Cl)c2)c(O)c1/C=N/N1CCOCC1 |
| InChI | InChI=1S/C15H15ClN4O3S/c16-10-2-1-3-11(8-10)20-14(22)12(13(21)18-15(20)24)9-17-19-4-6-23-7-5-19/h1-3,8-9,22H,4-7H2,(H,18,21,24)/b17-9+ |
| InChIKey | BRLCABITGVXIMQ-RQZCQDPDSA-N |
| XLogP | 1.92 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|