C17H20N4O2S — CID 135493355
6-hydroxy-1-(3-methylphenyl)-5-[(E)-piperidin-1-yliminomethyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 135493355) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 6-hydroxy-1-(3-methylphenyl)-5-[(E)-piperidin-1-yliminomethyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-hydroxy-1-(3-methylphenyl)-5-[(E)-piperidin-1-yliminomethyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135493355 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 6-hydroxy-1-(3-methylphenyl)-5-[(E)-piperidin-1-yliminomethyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cc1cccc(-n2c(O)c(/C=N/N3CCCCC3)c(=O)[nH]c2=S)c1 |
| InChI | InChI=1S/C17H20N4O2S/c1-12-6-5-7-13(10-12)21-16(23)14(15(22)19-17(21)24)11-18-20-8-3-2-4-9-20/h5-7,10-11,23H,2-4,8-9H2,1H3,(H,19,22,24)/b18-11+ |
| InChIKey | HCYJNYSVGAIPDU-WOJGMQOQSA-N |
| XLogP | 2.73 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|