C21H20ClN5O2S — CID 1386333
1-(3-chlorophenyl)-6-hydroxy-5-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 1386333) has the molecular formula C21H20ClN5O2S and a molecular weight of 441.94 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-6-hydroxy-5-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(3-chlorophenyl)-6-hydroxy-5-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 1386333 |
| Molecular Formula | C21H20ClN5O2S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 1-(3-chlorophenyl)-6-hydroxy-5-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2cccc(Cl)c2)c(O)c1C=NN1CCCC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C21H20ClN5O2S/c22-15-6-3-7-16(11-15)27-20(29)17(19(28)25-21(27)30)13-24-26-10-2-1-8-18(26)14-5-4-9-23-12-14/h3-7,9,11-13,18,29H,1-2,8,10H2,(H,25,28,30)/t18-/m0/s1 |
| InChIKey | BZQVWHFVZHQUBS-SFHVURJKSA-N |
| XLogP | 4.21 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|