C21H20ClN5O3 — CID 135974367
1-(2-chlorophenyl)-6-hydroxy-5-[(E)-[(2R)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]pyrimidine-2,4-dione (PubChem CID 135974367) has the molecular formula C21H20ClN5O3 and a molecular weight of 425.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-6-hydroxy-5-[(E)-[(2R)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(2-chlorophenyl)-6-hydroxy-5-[(E)-[(2R)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135974367 |
| Molecular Formula | C21H20ClN5O3 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-(2-chlorophenyl)-6-hydroxy-5-[(E)-[(2R)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2Cl)c(O)c1/C=N/N1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C21H20ClN5O3/c22-16-7-1-2-9-18(16)27-20(29)15(19(28)25-21(27)30)13-24-26-11-4-3-8-17(26)14-6-5-10-23-12-14/h1-2,5-7,9-10,12-13,17,29H,3-4,8,11H2,(H,25,28,30)/b24-13+/t17-/m1/s1 |
| InChIKey | WHDXBIDTJBDVJH-ZRWQFTNJSA-N |
| XLogP | 2.84 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|