C18H21N5O3 — CID 135544677
6-hydroxy-1-prop-2-enyl-5-[(E)-(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 135544677) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 6-hydroxy-1-prop-2-enyl-5-[(E)-(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-prop-2-enyl-5-[(E)-(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135544677 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 6-hydroxy-1-prop-2-enyl-5-[(E)-(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | C=CCn1c(O)c(/C=N/N2CCCCC2c2cccnc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H21N5O3/c1-2-9-22-17(25)14(16(24)21-18(22)26)12-20-23-10-4-3-7-15(23)13-6-5-8-19-11-13/h2,5-6,8,11-12,15,25H,1,3-4,7,9-10H2,(H,21,24,26)/b20-12+ |
| InChIKey | ADMQHTWKLVKEIQ-UDWIEESQSA-N |
| XLogP | 1.38 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|