C19H25N5O2S — CID 136828579
1-butyl-6-hydroxy-5-[[(2R)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 136828579) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is 1-butyl-6-hydroxy-5-[[(2R)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-butyl-6-hydroxy-5-[[(2R)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136828579 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-butyl-6-hydroxy-5-[[(2R)-2-pyridin-3-ylpiperidin-1-yl]iminomethyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCCCn1c(O)c(C=NN2CCCC[C@@H]2c2cccnc2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C19H25N5O2S/c1-2-3-10-23-18(26)15(17(25)22-19(23)27)13-21-24-11-5-4-8-16(24)14-7-6-9-20-12-14/h6-7,9,12-13,16,26H,2-5,8,10-11H2,1H3,(H,22,25,27)/t16-/m1/s1 |
| InChIKey | JPHMDTLJBJHDED-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|