C22H20F3N5O3 — CID 3312657
6-hydroxy-5-[(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione (PubChem CID 3312657) has the molecular formula C22H20F3N5O3 and a molecular weight of 459.43 g/mol. Its IUPAC name is 6-hydroxy-5-[(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3312657 |
| Molecular Formula | C22H20F3N5O3 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 6-hydroxy-5-[(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2cccc(C(F)(F)F)c2)c(O)c1C=NN1CCCCC1c1cccnc1 |
| InChI | InChI=1S/C22H20F3N5O3/c23-22(24,25)15-6-3-7-16(11-15)30-20(32)17(19(31)28-21(30)33)13-27-29-10-2-1-8-18(29)14-5-4-9-26-12-14/h3-7,9,11-13,18,32H,1-2,8,10H2,(H,28,31,33) |
| InChIKey | DXBDNJNTLHGDCC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|