C26H33N5O4 — CID 135517080
1-(4-ethylphenyl)-6-hydroxy-5-[(E)-(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]pyrimidine-2,4-dione;propan-2-ol (PubChem CID 135517080) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-6-hydroxy-5-[(E)-(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]pyrimidine-2,4-dione;propan-2-ol.
| Compound Name | 1-(4-ethylphenyl)-6-hydroxy-5-[(E)-(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]pyrimidine-2,4-dione;propan-2-ol |
|---|---|
| PubChem CID | 135517080 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 1-(4-ethylphenyl)-6-hydroxy-5-[(E)-(2-pyridin-3-ylpiperidin-1-yl)iminomethyl]pyrimidine-2,4-dione;propan-2-ol |
| SMILES | CC(C)O.CCc1ccc(-n2c(O)c(/C=N/N3CCCCC3c3cccnc3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H25N5O3.C3H8O/c1-2-16-8-10-18(11-9-16)28-22(30)19(21(29)26-23(28)31)15-25-27-13-4-3-7-20(27)17-6-5-12-24-14-17;1-3(2)4/h5-6,8-12,14-15,20,30H,2-4,7,13H2,1H3,(H,26,29,31);3-4H,1-2H3/b25-15+; |
| InChIKey | BPJNKTMDGRIRRS-BUWMAIPZSA-N |
| XLogP | 3.14 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|