C22H23N5O4 — CID 135947989
3-(4-methoxyphenyl)-2,6-dioxo-5-[(E)-(2-pyridin-1-ium-3-ylpiperidin-1-yl)iminomethyl]pyrimidin-4-olate (PubChem CID 135947989) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2,6-dioxo-5-[(E)-(2-pyridin-1-ium-3-ylpiperidin-1-yl)iminomethyl]pyrimidin-4-olate.
| Compound Name | 3-(4-methoxyphenyl)-2,6-dioxo-5-[(E)-(2-pyridin-1-ium-3-ylpiperidin-1-yl)iminomethyl]pyrimidin-4-olate |
|---|---|
| PubChem CID | 135947989 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-(4-methoxyphenyl)-2,6-dioxo-5-[(E)-(2-pyridin-1-ium-3-ylpiperidin-1-yl)iminomethyl]pyrimidin-4-olate |
| SMILES | COc1ccc(-n2c([O-])c(/C=N/N3CCCCC3c3ccc[nH+]c3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C22H23N5O4/c1-31-17-9-7-16(8-10-17)27-21(29)18(20(28)25-22(27)30)14-24-26-12-3-2-6-19(26)15-5-4-11-23-13-15/h4-5,7-11,13-14,19,29H,2-3,6,12H2,1H3,(H,25,28,30)/b24-14+ |
| InChIKey | RUPQNSCZHNSKEZ-ZVHZXABRSA-N |
| XLogP | 0.98 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|