C18H14ClN3O4 — CID 2844562
1-(4-chlorophenyl)-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 2844562) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-chlorophenyl)-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2844562 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 1-(4-chlorophenyl)-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(/N=C/c2c(O)n(-c3ccc(Cl)cc3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H14ClN3O4/c1-26-14-8-4-12(5-9-14)20-10-15-16(23)21-18(25)22(17(15)24)13-6-2-11(19)3-7-13/h2-10,24H,1H3,(H,21,23,25)/b20-10+ |
| InChIKey | JRUUZKCPYXLDGD-KEBDBYFISA-N |
| XLogP | 2.64 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|