C28H22N4O6 — CID 137070315
2-[[5-[[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-methylphenyl]methyl]isoindole-1,3-dione (PubChem CID 137070315) has the molecular formula C28H22N4O6 and a molecular weight of 510.51 g/mol. Its IUPAC name is 2-[[5-[[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-methylphenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-[[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-methylphenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 137070315 |
| Molecular Formula | C28H22N4O6 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 2-[[5-[[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-methylphenyl]methyl]isoindole-1,3-dione |
| SMILES | COc1ccc(-n2c(O)c(/C=N/c3ccc(C)c(CN4C(=O)c5ccccc5C4=O)c3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C28H22N4O6/c1-16-7-8-18(13-17(16)15-31-25(34)21-5-3-4-6-22(21)26(31)35)29-14-23-24(33)30-28(37)32(27(23)36)19-9-11-20(38-2)12-10-19/h3-14,36H,15H2,1-2H3,(H,30,33,37)/b29-14+ |
| InChIKey | TVPSBZYBBHFJAL-IPPBACCNSA-N |
| XLogP | 3.10 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|