C21H20N4O5 — CID 137073945
1-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-methoxyphenyl)urea (PubChem CID 137073945) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is 1-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 137073945 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N=Cc2c(O)n(-c3ccc(C)c(C)c3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H20N4O5/c1-12-4-7-15(10-13(12)2)25-19(27)17(18(26)24-21(25)29)11-22-20(28)23-14-5-8-16(30-3)9-6-14/h4-11,27H,1-3H3,(H,23,28)(H,24,26,29) |
| InChIKey | FVNDSNLKQLNLJI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|