C20H17BrN4O4 — CID 137073488
1-(4-bromophenyl)-3-[[1-(2,5-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]urea (PubChem CID 137073488) has the molecular formula C20H17BrN4O4 and a molecular weight of 457.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[[1-(2,5-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]urea.
| Compound Name | 1-(4-bromophenyl)-3-[[1-(2,5-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]urea |
|---|---|
| PubChem CID | 137073488 |
| Molecular Formula | C20H17BrN4O4 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 1-(4-bromophenyl)-3-[[1-(2,5-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]urea |
| SMILES | Cc1ccc(C)c(-n2c(O)c(C=NC(=O)Nc3ccc(Br)cc3)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C20H17BrN4O4/c1-11-3-4-12(2)16(9-11)25-18(27)15(17(26)24-20(25)29)10-22-19(28)23-14-7-5-13(21)6-8-14/h3-10,27H,1-2H3,(H,23,28)(H,24,26,29) |
| InChIKey | KQCYGESXMUXETB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|