C21H19N5O4S — CID 137074904
1-benzamido-3-[[1-(2,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]thiourea (PubChem CID 137074904) has the molecular formula C21H19N5O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 1-benzamido-3-[[1-(2,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]thiourea.
| Compound Name | 1-benzamido-3-[[1-(2,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]thiourea |
|---|---|
| PubChem CID | 137074904 |
| Molecular Formula | C21H19N5O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-benzamido-3-[[1-(2,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]thiourea |
| SMILES | Cc1ccc(-n2c(O)c(C=NC(=S)NNC(=O)c3ccccc3)c(=O)[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C21H19N5O4S/c1-12-8-9-16(13(2)10-12)26-19(29)15(18(28)23-21(26)30)11-22-20(31)25-24-17(27)14-6-4-3-5-7-14/h3-11,29H,1-2H3,(H,24,27)(H,25,31)(H,23,28,30) |
| InChIKey | LSRLCORWJDNSEB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|