C20H17ClN4O4 — CID 137070654
1-[[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(2,4-dimethylphenyl)urea (PubChem CID 137070654) has the molecular formula C20H17ClN4O4 and a molecular weight of 412.83 g/mol. Its IUPAC name is 1-[[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(2,4-dimethylphenyl)urea.
| Compound Name | 1-[[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(2,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 137070654 |
| Molecular Formula | C20H17ClN4O4 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-[[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(2,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N=Cc2c(O)n(-c3ccccc3Cl)c(=O)[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C20H17ClN4O4/c1-11-7-8-15(12(2)9-11)23-19(28)22-10-13-17(26)24-20(29)25(18(13)27)16-6-4-3-5-14(16)21/h3-10,27H,1-2H3,(H,23,28)(H,24,26,29) |
| InChIKey | ZEBTWCPDQQQCMN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|