C13H13ClN4O4 — CID 4288914
1-(2-chlorophenyl)-6-hydroxy-5-[(2-hydroxyethylhydrazinylidene)methyl]pyrimidine-2,4-dione (PubChem CID 4288914) has the molecular formula C13H13ClN4O4 and a molecular weight of 324.72 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-6-hydroxy-5-[(2-hydroxyethylhydrazinylidene)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-(2-chlorophenyl)-6-hydroxy-5-[(2-hydroxyethylhydrazinylidene)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4288914 |
| Molecular Formula | C13H13ClN4O4 |
| Molecular Weight | 324.72 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1-(2-chlorophenyl)-6-hydroxy-5-[(2-hydroxyethylhydrazinylidene)methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2Cl)c(O)c1C=NNCCO |
| InChI | InChI=1S/C13H13ClN4O4/c14-9-3-1-2-4-10(9)18-12(21)8(7-16-15-5-6-19)11(20)17-13(18)22/h1-4,7,15,19,21H,5-6H2,(H,17,20,22) |
| InChIKey | YEQVVJBKRSSPTR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.72 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|