C20H15ClN4O4 — CID 137070402
(E)-N-[[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylprop-2-enamide (PubChem CID 137070402) has the molecular formula C20H15ClN4O4 and a molecular weight of 410.82 g/mol. Its IUPAC name is (E)-N-[[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 137070402 |
| Molecular Formula | C20H15ClN4O4 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (E)-N-[[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NN=Cc1c(O)n(-c2ccccc2Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H15ClN4O4/c21-15-8-4-5-9-16(15)25-19(28)14(18(27)23-20(25)29)12-22-24-17(26)11-10-13-6-2-1-3-7-13/h1-12,28H,(H,24,26)(H,23,27,29)/b11-10+,22-12? |
| InChIKey | SAKNABZGNWMEBI-UQHVPXPYSA-N |
| XLogP | 2.05 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|