C17H10Cl2N4O5 — CID 137074698
5-[(4-chloro-3-nitrophenyl)iminomethyl]-1-(2-chlorophenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 137074698) has the molecular formula C17H10Cl2N4O5 and a molecular weight of 421.20 g/mol. Its IUPAC name is 5-[(4-chloro-3-nitrophenyl)iminomethyl]-1-(2-chlorophenyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[(4-chloro-3-nitrophenyl)iminomethyl]-1-(2-chlorophenyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137074698 |
| Molecular Formula | C17H10Cl2N4O5 |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | 5-[(4-chloro-3-nitrophenyl)iminomethyl]-1-(2-chlorophenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2Cl)c(O)c1/C=N/c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H10Cl2N4O5/c18-11-3-1-2-4-13(11)22-16(25)10(15(24)21-17(22)26)8-20-9-5-6-12(19)14(7-9)23(27)28/h1-8,25H,(H,21,24,26)/b20-8+ |
| InChIKey | LWOBISKFTQTOMD-DNTJNYDQSA-N |
| XLogP | 3.20 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|