C19H13Cl2N3O5 — CID 135628465
methyl 2-chloro-5-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate (PubChem CID 135628465) has the molecular formula C19H13Cl2N3O5 and a molecular weight of 434.24 g/mol. Its IUPAC name is methyl 2-chloro-5-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate.
| Compound Name | methyl 2-chloro-5-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 135628465 |
| Molecular Formula | C19H13Cl2N3O5 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | methyl 2-chloro-5-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate |
| SMILES | COC(=O)c1cc(/N=C/c2c(O)n(-c3cccc(Cl)c3)c(=O)[nH]c2=O)ccc1Cl |
| InChI | InChI=1S/C19H13Cl2N3O5/c1-29-18(27)13-8-11(5-6-15(13)21)22-9-14-16(25)23-19(28)24(17(14)26)12-4-2-3-10(20)7-12/h2-9,26H,1H3,(H,23,25,28)/b22-9+ |
| InChIKey | MVPSIYCBBBWDKI-LSFURLLWSA-N |
| XLogP | 3.08 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|