C21H19BrN4O4 — CID 137073957
1-[[1-(4-bromo-2,5-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-methylphenyl)urea (PubChem CID 137073957) has the molecular formula C21H19BrN4O4 and a molecular weight of 471.31 g/mol. Its IUPAC name is 1-[[1-(4-bromo-2,5-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-methylphenyl)urea.
| Compound Name | 1-[[1-(4-bromo-2,5-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 137073957 |
| Molecular Formula | C21H19BrN4O4 |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 1-[[1-(4-bromo-2,5-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N=Cc2c(O)n(-c3cc(C)c(Br)cc3C)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H19BrN4O4/c1-11-4-6-14(7-5-11)24-20(29)23-10-15-18(27)25-21(30)26(19(15)28)17-9-12(2)16(22)8-13(17)3/h4-10,28H,1-3H3,(H,24,29)(H,25,27,30) |
| InChIKey | DBENRXXWUZEDEX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|