C20H20N4O5S — CID 137073647
4-[[1-(2,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N-methylbenzenesulfonamide (PubChem CID 137073647) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is 4-[[1-(2,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N-methylbenzenesulfonamide.
| Compound Name | 4-[[1-(2,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 137073647 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-[[1-(2,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(/N=C/c2c(O)n(-c3ccc(C)cc3C)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H20N4O5S/c1-12-4-9-17(13(2)10-12)24-19(26)16(18(25)23-20(24)27)11-22-14-5-7-15(8-6-14)30(28,29)21-3/h4-11,21,26H,1-3H3,(H,23,25,27)/b22-11+ |
| InChIKey | KVEOQJLEPARSHZ-SSDVNMTOSA-N |
| XLogP | 1.51 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|