C20H19N3O6S — CID 1087260
6-hydroxy-5-[[4-(2-hydroxyethylsulfonyl)phenyl]iminomethyl]-1-(3-methylphenyl)pyrimidine-2,4-dione (PubChem CID 1087260) has the molecular formula C20H19N3O6S and a molecular weight of 429.45 g/mol. Its IUPAC name is 6-hydroxy-5-[[4-(2-hydroxyethylsulfonyl)phenyl]iminomethyl]-1-(3-methylphenyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[[4-(2-hydroxyethylsulfonyl)phenyl]iminomethyl]-1-(3-methylphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1087260 |
| Molecular Formula | C20H19N3O6S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 6-hydroxy-5-[[4-(2-hydroxyethylsulfonyl)phenyl]iminomethyl]-1-(3-methylphenyl)pyrimidine-2,4-dione |
| SMILES | Cc1cccc(-n2c(O)c(/C=N/c3ccc(S(=O)(=O)CCO)cc3)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C20H19N3O6S/c1-13-3-2-4-15(11-13)23-19(26)17(18(25)22-20(23)27)12-21-14-5-7-16(8-6-14)30(28,29)10-9-24/h2-8,11-12,24,26H,9-10H2,1H3,(H,22,25,27)/b21-12+ |
| InChIKey | RPAIDQKFCFXGBQ-CIAFOILYSA-N |
| XLogP | 1.06 |
| TPSA | 141.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|