C25H23N3O4S — CID 2533951
4-[[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-N-methylbenzenesulfonamide (PubChem CID 2533951) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-N-methylbenzenesulfonamide.
| Compound Name | 4-[[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2533951 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 4-[[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(/N=C/c2c(O)n(-c3ccc(C)c(C)c3)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-16-8-11-19(14-17(16)2)28-24(29)22-7-5-4-6-21(22)23(25(28)30)15-27-18-9-12-20(13-10-18)33(31,32)26-3/h4-15,26,30H,1-3H3/b27-15+ |
| InChIKey | FFQMTIQORUVYCD-JFLMPSFJSA-N |
| XLogP | 3.97 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|