C27H27N5O4S — CID 135875747
N-[3-hydroxy-4-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1-oxo-2H-isoquinolin-6-yl]benzenesulfonamide (PubChem CID 135875747) has the molecular formula C27H27N5O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is N-[3-hydroxy-4-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1-oxo-2H-isoquinolin-6-yl]benzenesulfonamide.
| Compound Name | N-[3-hydroxy-4-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1-oxo-2H-isoquinolin-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 135875747 |
| Molecular Formula | C27H27N5O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[3-hydroxy-4-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1-oxo-2H-isoquinolin-6-yl]benzenesulfonamide |
| SMILES | CN1CCN(c2ccc(/N=C/c3c(O)[nH]c(=O)c4ccc(NS(=O)(=O)c5ccccc5)cc34)cc2)CC1 |
| InChI | InChI=1S/C27H27N5O4S/c1-31-13-15-32(16-14-31)21-10-7-19(8-11-21)28-18-25-24-17-20(9-12-23(24)26(33)29-27(25)34)30-37(35,36)22-5-3-2-4-6-22/h2-12,17-18,30H,13-16H2,1H3,(H2,29,33,34)/b28-18+ |
| InChIKey | BWQQNVYOZZUWPH-MTDXEUNCSA-N |
| XLogP | 3.54 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|