C30H30N4O3 — CID 135875730
6-(4-acetylanilino)-3-hydroxy-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-1-one (PubChem CID 135875730) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is 6-(4-acetylanilino)-3-hydroxy-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-1-one.
| Compound Name | 6-(4-acetylanilino)-3-hydroxy-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 135875730 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 6-(4-acetylanilino)-3-hydroxy-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-1-one |
| SMILES | CC(=O)c1ccc(Nc2ccc3c(=O)[nH]c(O)c(/C=N/c4ccc(CN5CCCCC5)cc4)c3c2)cc1 |
| InChI | InChI=1S/C30H30N4O3/c1-20(35)22-7-11-24(12-8-22)32-25-13-14-26-27(17-25)28(30(37)33-29(26)36)18-31-23-9-5-21(6-10-23)19-34-15-3-2-4-16-34/h5-14,17-18,32H,2-4,15-16,19H2,1H3,(H2,33,36,37)/b31-18+ |
| InChIKey | YSALHWCFIFUNAF-FDAWAROLSA-N |
| XLogP | 5.92 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|