C20H17N3O5 — CID 135784323
methyl 3-[[6-hydroxy-1-(2-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate (PubChem CID 135784323) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is methyl 3-[[6-hydroxy-1-(2-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate.
| Compound Name | methyl 3-[[6-hydroxy-1-(2-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 135784323 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | methyl 3-[[6-hydroxy-1-(2-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate |
| SMILES | COC(=O)c1cccc(/N=C/c2c(O)n(-c3ccccc3C)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C20H17N3O5/c1-12-6-3-4-9-16(12)23-18(25)15(17(24)22-20(23)27)11-21-14-8-5-7-13(10-14)19(26)28-2/h3-11,25H,1-2H3,(H,22,24,27)/b21-11+ |
| InChIKey | ZFQACBFJVDCLAD-SRZZPIQSSA-N |
| XLogP | 2.08 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|