C20H18N4O3S — CID 1389847
N-[4-[[6-hydroxy-1-(2-methylphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]phenyl]acetamide (PubChem CID 1389847) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is N-[4-[[6-hydroxy-1-(2-methylphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]phenyl]acetamide.
| Compound Name | N-[4-[[6-hydroxy-1-(2-methylphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]phenyl]acetamide |
|---|---|
| PubChem CID | 1389847 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-[4-[[6-hydroxy-1-(2-methylphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/N=C/c2c(O)n(-c3ccccc3C)c(=S)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H18N4O3S/c1-12-5-3-4-6-17(12)24-19(27)16(18(26)23-20(24)28)11-21-14-7-9-15(10-8-14)22-13(2)25/h3-11,27H,1-2H3,(H,22,25)(H,23,26,28)/b21-11+ |
| InChIKey | PXDUASZHKXHXJZ-SRZZPIQSSA-N |
| XLogP | 3.62 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|