C19H16FN3O2S — CID 3868495
5-[(2,5-dimethylphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 3868495) has the molecular formula C19H16FN3O2S and a molecular weight of 369.42 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(2,5-dimethylphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 3868495 |
| Molecular Formula | C19H16FN3O2S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 5-[(2,5-dimethylphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cc1ccc(C)c(/N=C/c2c(O)n(-c3ccccc3F)c(=S)[nH]c2=O)c1 |
| InChI | InChI=1S/C19H16FN3O2S/c1-11-7-8-12(2)15(9-11)21-10-13-17(24)22-19(26)23(18(13)25)16-6-4-3-5-14(16)20/h3-10,25H,1-2H3,(H,22,24,26)/b21-10+ |
| InChIKey | LUQYZDLSPOEQSJ-UFFVCSGVSA-N |
| XLogP | 4.11 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|