C20H16FN3O4S — CID 2924714
ethyl 4-[[1-(2-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzoate (PubChem CID 2924714) has the molecular formula C20H16FN3O4S and a molecular weight of 413.43 g/mol. Its IUPAC name is ethyl 4-[[1-(2-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzoate.
| Compound Name | ethyl 4-[[1-(2-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 2924714 |
| Molecular Formula | C20H16FN3O4S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | ethyl 4-[[1-(2-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C/c2c(O)n(-c3ccccc3F)c(=S)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H16FN3O4S/c1-2-28-19(27)12-7-9-13(10-8-12)22-11-14-17(25)23-20(29)24(18(14)26)16-6-4-3-5-15(16)21/h3-11,26H,2H2,1H3,(H,23,25,29)/b22-11+ |
| InChIKey | VADTVKYMUJIMRJ-SSDVNMTOSA-N |
| XLogP | 3.67 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|