C20H16BrN3O5 — CID 137075405
3-[[1-(4-bromo-2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoic acid (PubChem CID 137075405) has the molecular formula C20H16BrN3O5 and a molecular weight of 458.27 g/mol. Its IUPAC name is 3-[[1-(4-bromo-2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoic acid.
| Compound Name | 3-[[1-(4-bromo-2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 137075405 |
| Molecular Formula | C20H16BrN3O5 |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 3-[[1-(4-bromo-2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoic acid |
| SMILES | CCc1cc(Br)ccc1-n1c(O)c(/C=N/c2cccc(C(=O)O)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H16BrN3O5/c1-2-11-8-13(21)6-7-16(11)24-18(26)15(17(25)23-20(24)29)10-22-14-5-3-4-12(9-14)19(27)28/h3-10,26H,2H2,1H3,(H,27,28)(H,23,25,29)/b22-10+ |
| InChIKey | BFZDCUNVKOSBKO-LSHDLFTRSA-N |
| XLogP | 3.01 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|