C19H15BrClN3O4 — CID 137073331
1-(4-bromo-2-ethylphenyl)-5-[(5-chloro-2-hydroxyphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 137073331) has the molecular formula C19H15BrClN3O4 and a molecular weight of 464.70 g/mol. Its IUPAC name is 1-(4-bromo-2-ethylphenyl)-5-[(5-chloro-2-hydroxyphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(4-bromo-2-ethylphenyl)-5-[(5-chloro-2-hydroxyphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137073331 |
| Molecular Formula | C19H15BrClN3O4 |
| Molecular Weight | 464.70 g/mol |
| Exact Mass | 462.99 |
| IUPAC Name | 1-(4-bromo-2-ethylphenyl)-5-[(5-chloro-2-hydroxyphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCc1cc(Br)ccc1-n1c(O)c(/C=N/c2cc(Cl)ccc2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H15BrClN3O4/c1-2-10-7-11(20)3-5-15(10)24-18(27)13(17(26)23-19(24)28)9-22-14-8-12(21)4-6-16(14)25/h3-9,25,27H,2H2,1H3,(H,23,26,28)/b22-9+ |
| InChIKey | YEADMIGTPYSGEL-LSFURLLWSA-N |
| XLogP | 3.67 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|