C22H19BrN6O6 — CID 137073632
1-(4-bromo-2-ethylphenyl)-5-[(1,3-dimethyl-6-nitro-2-oxobenzimidazol-5-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 137073632) has the molecular formula C22H19BrN6O6 and a molecular weight of 543.33 g/mol. Its IUPAC name is 1-(4-bromo-2-ethylphenyl)-5-[(1,3-dimethyl-6-nitro-2-oxobenzimidazol-5-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(4-bromo-2-ethylphenyl)-5-[(1,3-dimethyl-6-nitro-2-oxobenzimidazol-5-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137073632 |
| Molecular Formula | C22H19BrN6O6 |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | 1-(4-bromo-2-ethylphenyl)-5-[(1,3-dimethyl-6-nitro-2-oxobenzimidazol-5-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCc1cc(Br)ccc1-n1c(O)c(/C=N/c2cc3c(cc2[N+](=O)[O-])n(C)c(=O)n3C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H19BrN6O6/c1-4-11-7-12(23)5-6-15(11)28-20(31)13(19(30)25-21(28)32)10-24-14-8-17-18(9-16(14)29(34)35)27(3)22(33)26(17)2/h5-10,31H,4H2,1-3H3,(H,25,30,32)/b24-10+ |
| InChIKey | NUZIVUBCWQQBNO-YSURURNPSA-N |
| XLogP | 2.41 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|