C22H20N6O6 — CID 137070529
5-[(1,3-diethyl-6-nitro-2-oxobenzimidazol-5-yl)iminomethyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione (PubChem CID 137070529) has the molecular formula C22H20N6O6 and a molecular weight of 464.44 g/mol. Its IUPAC name is 5-[(1,3-diethyl-6-nitro-2-oxobenzimidazol-5-yl)iminomethyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione.
| Compound Name | 5-[(1,3-diethyl-6-nitro-2-oxobenzimidazol-5-yl)iminomethyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137070529 |
| Molecular Formula | C22H20N6O6 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 5-[(1,3-diethyl-6-nitro-2-oxobenzimidazol-5-yl)iminomethyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione |
| SMILES | CCn1c(=O)n(CC)c2cc([N+](=O)[O-])c(/N=C/c3c(O)n(-c4ccccc4)c(=O)[nH]c3=O)cc21 |
| InChI | InChI=1S/C22H20N6O6/c1-3-25-17-10-15(16(28(33)34)11-18(17)26(4-2)22(25)32)23-12-14-19(29)24-21(31)27(20(14)30)13-8-6-5-7-9-13/h5-12,30H,3-4H2,1-2H3,(H,24,29,31)/b23-12+ |
| InChIKey | DWQSCUVOZLLSFE-FSJBWODESA-N |
| XLogP | 2.05 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|